About tert-butyl (5R)-5-ethenyl-4-(2-hydroxyethyl)-2-oxo-1,3-dioxane-4-carboxylate
tert-butyl (5R)-5-ethenyl-4-(2-hydroxyethyl)-2-oxo-1,3-dioxane-4-carboxylate (PubChem CID 134855114) has the molecular formula C13H20O6
and a molecular weight of 272.30 g/mol. Its IUPAC name is tert-butyl (5R)-5-ethenyl-4-(2-hydroxyethyl)-2-oxo-1,3-dioxane-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (5R)-5-ethenyl-4-(2-hydroxyethyl)-2-oxo-1,3-dioxane-4-carboxylate |
| PubChem CID | 134855114 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | tert-butyl (5R)-5-ethenyl-4-(2-hydroxyethyl)-2-oxo-1,3-dioxane-4-carboxylate |
| SMILES | C=C[C@@H]1COC(=O)OC1(CCO)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H20O6/c1-5-9-8-17-11(16)19-13(9,6-7-14)10(15)18-12(2,3)4/h5,9,14H,1,6-8H2,2-4H3/t9-,13?/m1/s1 |
| InChIKey | CNTUSGRINIECPK-CGCSKFHYSA-N |
| XLogP | 1.42 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (5R)-5-ethenyl-4-(2-hydroxyethyl)-2-oxo-1,3-dioxane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (5R)-5-ethenyl-4-(2-hydroxyethyl)-2-oxo-1,3-dioxane-4-carboxylate?
The IUPAC name of tert-butyl (5R)-5-ethenyl-4-(2-hydroxyethyl)-2-oxo-1,3-dioxane-4-carboxylate (CID 134855114) is tert-butyl (5R)-5-ethenyl-4-(2-hydroxyethyl)-2-oxo-1,3-dioxane-4-carboxylate.
What is the SMILES notation for tert-butyl (5R)-5-ethenyl-4-(2-hydroxyethyl)-2-oxo-1,3-dioxane-4-carboxylate?
The canonical SMILES for tert-butyl (5R)-5-ethenyl-4-(2-hydroxyethyl)-2-oxo-1,3-dioxane-4-carboxylate is C=C[C@@H]1COC(=O)OC1(CCO)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (5R)-5-ethenyl-4-(2-hydroxyethyl)-2-oxo-1,3-dioxane-4-carboxylate?
The InChIKey is CNTUSGRINIECPK-CGCSKFHYSA-N. The full InChI is InChI=1S/C13H20O6/c1-5-9-8-17-11(16)19-13(9,6-7-14)10(15)18-12(2,3)4/h5,9,14H,1,6-8H2,2-4H3/t9-,13?/m1/s1.
What are the key properties of tert-butyl (5R)-5-ethenyl-4-(2-hydroxyethyl)-2-oxo-1,3-dioxane-4-carboxylate?
tert-butyl (5R)-5-ethenyl-4-(2-hydroxyethyl)-2-oxo-1,3-dioxane-4-carboxylate has a molecular weight of 272.30 g/mol, XLogP of 1.42, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (5R)-5-ethenyl-4-(2-hydroxyethyl)-2-oxo-1,3-dioxane-4-carboxylate is sourced from PubChem (CID 134855114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).