C17H29O2+ — CID 134855132
methyl (E)-3-methyl-5-(2,2,3,6-tetramethylcyclohexyl)pent-2-enoate (PubChem CID 134855132) has the molecular formula C17H29O2+ and a molecular weight of 265.42 g/mol. Its IUPAC name is methyl (E)-3-methyl-5-(2,2,3,6-tetramethylcyclohexyl)pent-2-enoate.
| Compound Name | methyl (E)-3-methyl-5-(2,2,3,6-tetramethylcyclohexyl)pent-2-enoate |
|---|---|
| PubChem CID | 134855132 |
| Molecular Formula | C17H29O2+ |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | methyl (E)-3-methyl-5-(2,2,3,6-tetramethylcyclohexyl)pent-2-enoate |
| SMILES | COC(=O)/C=C(\C)CCC1[C+](C)CCC(C)C1(C)C |
| InChI | InChI=1S/C17H29O2/c1-12(11-16(18)19-6)7-10-15-13(2)8-9-14(3)17(15,4)5/h11,14-15H,7-10H2,1-6H3/q+1/b12-11+ |
| InChIKey | ZWURVTLCCQMCGH-VAWYXSNFSA-N |
| XLogP | 4.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|