About (5R)-1,2-dimethyl-5-prop-1-en-2-ylpyrrolidine
(5R)-1,2-dimethyl-5-prop-1-en-2-ylpyrrolidine (PubChem CID 134855165) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is (5R)-1,2-dimethyl-5-prop-1-en-2-ylpyrrolidine.
Molecular Properties
| Compound Name | (5R)-1,2-dimethyl-5-prop-1-en-2-ylpyrrolidine |
| PubChem CID | 134855165 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | (5R)-1,2-dimethyl-5-prop-1-en-2-ylpyrrolidine |
| SMILES | C=C(C)[C@H]1CCC(C)N1C |
| InChI | InChI=1S/C9H17N/c1-7(2)9-6-5-8(3)10(9)4/h8-9H,1,5-6H2,2-4H3/t8?,9-/m1/s1 |
| InChIKey | CCLBEVSSXCBYDI-YGPZHTELSA-N |
| XLogP | 2.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5R)-1,2-dimethyl-5-prop-1-en-2-ylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-1,2-dimethyl-5-prop-1-en-2-ylpyrrolidine?
The IUPAC name of (5R)-1,2-dimethyl-5-prop-1-en-2-ylpyrrolidine (CID 134855165) is (5R)-1,2-dimethyl-5-prop-1-en-2-ylpyrrolidine.
What is the SMILES notation for (5R)-1,2-dimethyl-5-prop-1-en-2-ylpyrrolidine?
The canonical SMILES for (5R)-1,2-dimethyl-5-prop-1-en-2-ylpyrrolidine is C=C(C)[C@H]1CCC(C)N1C.
What is the InChIKey of (5R)-1,2-dimethyl-5-prop-1-en-2-ylpyrrolidine?
The InChIKey is CCLBEVSSXCBYDI-YGPZHTELSA-N. The full InChI is InChI=1S/C9H17N/c1-7(2)9-6-5-8(3)10(9)4/h8-9H,1,5-6H2,2-4H3/t8?,9-/m1/s1.
What are the key properties of (5R)-1,2-dimethyl-5-prop-1-en-2-ylpyrrolidine?
(5R)-1,2-dimethyl-5-prop-1-en-2-ylpyrrolidine has a molecular weight of 139.24 g/mol, XLogP of 2.05, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-1,2-dimethyl-5-prop-1-en-2-ylpyrrolidine is sourced from PubChem (CID 134855165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).