C11H12Br6 — CID 134855229
(4R,8S,9R)-3,4,8,9,11,11-hexabromotricyclo[4.4.1.01,6]undecane (PubChem CID 134855229) has the molecular formula C11H12Br6 and a molecular weight of 623.64 g/mol. Its IUPAC name is (4R,8S,9R)-3,4,8,9,11,11-hexabromotricyclo[4.4.1.01,6]undecane.
| Compound Name | (4R,8S,9R)-3,4,8,9,11,11-hexabromotricyclo[4.4.1.01,6]undecane |
|---|---|
| PubChem CID | 134855229 |
| Molecular Formula | C11H12Br6 |
| Molecular Weight | 623.64 g/mol |
| Exact Mass | 617.60 |
| IUPAC Name | (4R,8S,9R)-3,4,8,9,11,11-hexabromotricyclo[4.4.1.01,6]undecane |
| SMILES | BrC1CC23C[C@@H](Br)[C@@H](Br)CC2(C[C@H]1Br)C3(Br)Br |
| InChI | InChI=1S/C11H12Br6/c12-5-1-9-2-7(14)8(15)4-10(9,3-6(5)13)11(9,16)17/h5-8H,1-4H2/t5-,6+,7+,8?,9?,10?/m0/s1 |
| InChIKey | FFRHFZNJYAGNLX-BNIDNGKSSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.64 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|