C14H23BO4 — CID 134855285
ethyl 2-[(4S,5S,6R)-5-methyl-6-prop-1-en-2-yl-2-prop-2-enyl-1,3,2-dioxaborinan-4-yl]acetate (PubChem CID 134855285) has the molecular formula C14H23BO4 and a molecular weight of 266.15 g/mol. Its IUPAC name is ethyl 2-[(4S,5S,6R)-5-methyl-6-prop-1-en-2-yl-2-prop-2-enyl-1,3,2-dioxaborinan-4-yl]acetate.
| Compound Name | ethyl 2-[(4S,5S,6R)-5-methyl-6-prop-1-en-2-yl-2-prop-2-enyl-1,3,2-dioxaborinan-4-yl]acetate |
|---|---|
| PubChem CID | 134855285 |
| Molecular Formula | C14H23BO4 |
| Molecular Weight | 266.15 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | ethyl 2-[(4S,5S,6R)-5-methyl-6-prop-1-en-2-yl-2-prop-2-enyl-1,3,2-dioxaborinan-4-yl]acetate |
| SMILES | C=CCB1O[C@@H](CC(=O)OCC)[C@H](C)[C@H](C(=C)C)O1 |
| InChI | InChI=1S/C14H23BO4/c1-6-8-15-18-12(9-13(16)17-7-2)11(5)14(19-15)10(3)4/h6,11-12,14H,1,3,7-9H2,2,4-5H3/t11-,12-,14-/m0/s1 |
| InChIKey | IZOOZGIVZPWEAF-OBJOEFQTSA-N |
| XLogP | 2.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.15 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|