C17H17NO — CID 134855348
(4S,6R)-3-methyl-4,6-diphenyl-5,6-dihydro-4H-oxazine (PubChem CID 134855348) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is (4S,6R)-3-methyl-4,6-diphenyl-5,6-dihydro-4H-oxazine.
| Compound Name | (4S,6R)-3-methyl-4,6-diphenyl-5,6-dihydro-4H-oxazine |
|---|---|
| PubChem CID | 134855348 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (4S,6R)-3-methyl-4,6-diphenyl-5,6-dihydro-4H-oxazine |
| SMILES | CC1=NO[C@@H](c2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H17NO/c1-13-16(14-8-4-2-5-9-14)12-17(19-18-13)15-10-6-3-7-11-15/h2-11,16-17H,12H2,1H3/t16-,17-/m1/s1 |
| InChIKey | DPTMXMRZOCUSKU-IAGOWNOFSA-N |
| XLogP | 4.31 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |