About 1-[(3R)-3-chloro-2,2-difluorocyclopropyl]ethanone
1-[(3R)-3-chloro-2,2-difluorocyclopropyl]ethanone (PubChem CID 134855549) has the molecular formula C5H5ClF2O
and a molecular weight of 154.54 g/mol. Its IUPAC name is 1-[(3R)-3-chloro-2,2-difluorocyclopropyl]ethanone.
Molecular Properties
| Compound Name | 1-[(3R)-3-chloro-2,2-difluorocyclopropyl]ethanone |
| PubChem CID | 134855549 |
| Molecular Formula | C5H5ClF2O |
| Molecular Weight | 154.54 g/mol |
| Exact Mass | 154.00 |
| IUPAC Name | 1-[(3R)-3-chloro-2,2-difluorocyclopropyl]ethanone |
| SMILES | CC(=O)C1[C@@H](Cl)C1(F)F |
| InChI | InChI=1S/C5H5ClF2O/c1-2(9)3-4(6)5(3,7)8/h3-4H,1H3/t3?,4-/m1/s1 |
| InChIKey | INXGJQHVCFLNFU-SRBOSORUSA-N |
| XLogP | 1.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.54 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3R)-3-chloro-2,2-difluorocyclopropyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R)-3-chloro-2,2-difluorocyclopropyl]ethanone?
The IUPAC name of 1-[(3R)-3-chloro-2,2-difluorocyclopropyl]ethanone (CID 134855549) is 1-[(3R)-3-chloro-2,2-difluorocyclopropyl]ethanone.
What is the SMILES notation for 1-[(3R)-3-chloro-2,2-difluorocyclopropyl]ethanone?
The canonical SMILES for 1-[(3R)-3-chloro-2,2-difluorocyclopropyl]ethanone is CC(=O)C1[C@@H](Cl)C1(F)F.
What is the InChIKey of 1-[(3R)-3-chloro-2,2-difluorocyclopropyl]ethanone?
The InChIKey is INXGJQHVCFLNFU-SRBOSORUSA-N. The full InChI is InChI=1S/C5H5ClF2O/c1-2(9)3-4(6)5(3,7)8/h3-4H,1H3/t3?,4-/m1/s1.
What are the key properties of 1-[(3R)-3-chloro-2,2-difluorocyclopropyl]ethanone?
1-[(3R)-3-chloro-2,2-difluorocyclopropyl]ethanone has a molecular weight of 154.54 g/mol, XLogP of 1.45, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R)-3-chloro-2,2-difluorocyclopropyl]ethanone is sourced from PubChem (CID 134855549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).