About 1-bromoethylbenzene;rutherfordium
1-bromoethylbenzene;rutherfordium (PubChem CID 134855619) has the molecular formula C8H8BrRf-
and a molecular weight of 451.06 g/mol. Its IUPAC name is 1-bromoethylbenzene;rutherfordium.
Molecular Properties
| Compound Name | 1-bromoethylbenzene;rutherfordium |
| PubChem CID | 134855619 |
| Molecular Formula | C8H8BrRf- |
| Molecular Weight | 451.06 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 1-bromoethylbenzene;rutherfordium |
| SMILES | CC(Br)c1cc[c-]cc1.[Rf] |
| InChI | InChI=1S/C8H8Br.Rf/c1-7(9)8-5-3-2-4-6-8;/h3-7H,1H3;/q-1; |
| InChIKey | TYSKUIQZPLVCGZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.06 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-bromoethylbenzene;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromoethylbenzene;rutherfordium?
The IUPAC name of 1-bromoethylbenzene;rutherfordium (CID 134855619) is 1-bromoethylbenzene;rutherfordium.
What is the SMILES notation for 1-bromoethylbenzene;rutherfordium?
The canonical SMILES for 1-bromoethylbenzene;rutherfordium is CC(Br)c1cc[c-]cc1.[Rf].
What is the InChIKey of 1-bromoethylbenzene;rutherfordium?
The InChIKey is TYSKUIQZPLVCGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Br.Rf/c1-7(9)8-5-3-2-4-6-8;/h3-7H,1H3;/q-1;.
What are the key properties of 1-bromoethylbenzene;rutherfordium?
1-bromoethylbenzene;rutherfordium has a molecular weight of 451.06 g/mol, XLogP of 2.94, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromoethylbenzene;rutherfordium is sourced from PubChem (CID 134855619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).