About spiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane]
spiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane] (PubChem CID 134855638) has the molecular formula C8H10S
and a molecular weight of 138.24 g/mol. Its IUPAC name is spiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane].
Molecular Properties
| Compound Name | spiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane] |
| PubChem CID | 134855638 |
| Molecular Formula | C8H10S |
| Molecular Weight | 138.24 g/mol |
| Exact Mass | 138.05 |
| IUPAC Name | spiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane] |
| SMILES | C1=CC2CC1CC21CS1 |
| InChI | InChI=1S/C8H10S/c1-2-7-3-6(1)4-8(7)5-9-8/h1-2,6-7H,3-5H2 |
| InChIKey | HAZUIGFIYAUDLJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze spiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane]?
The IUPAC name of spiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane] (CID 134855638) is spiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane].
What is the SMILES notation for spiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane]?
The canonical SMILES for spiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane] is C1=CC2CC1CC21CS1.
What is the InChIKey of spiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane]?
The InChIKey is HAZUIGFIYAUDLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10S/c1-2-7-3-6(1)4-8(7)5-9-8/h1-2,6-7H,3-5H2.
What are the key properties of spiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane]?
spiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane] has a molecular weight of 138.24 g/mol, XLogP of 2.07, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[bicyclo[2.2.1]hept-2-ene-5,2'-thiirane] is sourced from PubChem (CID 134855638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).