About (10aR,10bS)-10a,10b-dihydrobenzo[h]quinoline
(10aR,10bS)-10a,10b-dihydrobenzo[h]quinoline (PubChem CID 134855711) has the molecular formula C13H11N
and a molecular weight of 181.24 g/mol. Its IUPAC name is (10aR,10bS)-10a,10b-dihydrobenzo[h]quinoline.
Molecular Properties
| Compound Name | (10aR,10bS)-10a,10b-dihydrobenzo[h]quinoline |
| PubChem CID | 134855711 |
| Molecular Formula | C13H11N |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (10aR,10bS)-10a,10b-dihydrobenzo[h]quinoline |
| SMILES | C1=CC2=CC=C3C=CC=N[C@H]3[C@@H]2C=C1 |
| InChI | InChI=1S/C13H11N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9,12-13H/t12-,13-/m1/s1 |
| InChIKey | LCLSYQXGQDBPBW-CHWSQXEVSA-N |
| XLogP | 2.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (10aR,10bS)-10a,10b-dihydrobenzo[h]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (10aR,10bS)-10a,10b-dihydrobenzo[h]quinoline?
The IUPAC name of (10aR,10bS)-10a,10b-dihydrobenzo[h]quinoline (CID 134855711) is (10aR,10bS)-10a,10b-dihydrobenzo[h]quinoline.
What is the SMILES notation for (10aR,10bS)-10a,10b-dihydrobenzo[h]quinoline?
The canonical SMILES for (10aR,10bS)-10a,10b-dihydrobenzo[h]quinoline is C1=CC2=CC=C3C=CC=N[C@H]3[C@@H]2C=C1.
What is the InChIKey of (10aR,10bS)-10a,10b-dihydrobenzo[h]quinoline?
The InChIKey is LCLSYQXGQDBPBW-CHWSQXEVSA-N. The full InChI is InChI=1S/C13H11N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9,12-13H/t12-,13-/m1/s1.
What are the key properties of (10aR,10bS)-10a,10b-dihydrobenzo[h]quinoline?
(10aR,10bS)-10a,10b-dihydrobenzo[h]quinoline has a molecular weight of 181.24 g/mol, XLogP of 2.60, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (10aR,10bS)-10a,10b-dihydrobenzo[h]quinoline is sourced from PubChem (CID 134855711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).