C13H22O6 — CID 134855765
(Z,5R)-5-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]pent-2-ene-1,5-diol (PubChem CID 134855765) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is (Z,5R)-5-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]pent-2-ene-1,5-diol.
| Compound Name | (Z,5R)-5-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]pent-2-ene-1,5-diol |
|---|---|
| PubChem CID | 134855765 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (Z,5R)-5-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]pent-2-ene-1,5-diol |
| SMILES | CO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H](O)C/C=C\CO |
| InChI | InChI=1S/C13H22O6/c1-13(2)18-11-10(16-3)9(17-12(11)19-13)8(15)6-4-5-7-14/h4-5,8-12,14-15H,6-7H2,1-3H3/b5-4-/t8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | UOXMGIPLUQMDIL-UCOHZSOJSA-N |
| XLogP | 0.18 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|