About (5S)-5-(2,3-dimethylbut-3-enyl)-2,2-dimethylthian-4-one
(5S)-5-(2,3-dimethylbut-3-enyl)-2,2-dimethylthian-4-one (PubChem CID 134855805) has the molecular formula C13H21OS+
and a molecular weight of 225.38 g/mol. Its IUPAC name is (5S)-5-(2,3-dimethylbut-3-enyl)-2,2-dimethylthian-4-one.
Molecular Properties
| Compound Name | (5S)-5-(2,3-dimethylbut-3-enyl)-2,2-dimethylthian-4-one |
| PubChem CID | 134855805 |
| Molecular Formula | C13H21OS+ |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | (5S)-5-(2,3-dimethylbut-3-enyl)-2,2-dimethylthian-4-one |
| SMILES | C=C(C)[C+](C)C[C@@H]1CSC(C)(C)CC1=O |
| InChI | InChI=1S/C13H21OS/c1-9(2)10(3)6-11-8-15-13(4,5)7-12(11)14/h11H,1,6-8H2,2-5H3/q+1/t11-/m1/s1 |
| InChIKey | ZBOOBBDNYNUTRB-LLVKDONJSA-N |
| XLogP | 3.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-(2,3-dimethylbut-3-enyl)-2,2-dimethylthian-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-(2,3-dimethylbut-3-enyl)-2,2-dimethylthian-4-one?
The IUPAC name of (5S)-5-(2,3-dimethylbut-3-enyl)-2,2-dimethylthian-4-one (CID 134855805) is (5S)-5-(2,3-dimethylbut-3-enyl)-2,2-dimethylthian-4-one.
What is the SMILES notation for (5S)-5-(2,3-dimethylbut-3-enyl)-2,2-dimethylthian-4-one?
The canonical SMILES for (5S)-5-(2,3-dimethylbut-3-enyl)-2,2-dimethylthian-4-one is C=C(C)[C+](C)C[C@@H]1CSC(C)(C)CC1=O.
What is the InChIKey of (5S)-5-(2,3-dimethylbut-3-enyl)-2,2-dimethylthian-4-one?
The InChIKey is ZBOOBBDNYNUTRB-LLVKDONJSA-N. The full InChI is InChI=1S/C13H21OS/c1-9(2)10(3)6-11-8-15-13(4,5)7-12(11)14/h11H,1,6-8H2,2-5H3/q+1/t11-/m1/s1.
What are the key properties of (5S)-5-(2,3-dimethylbut-3-enyl)-2,2-dimethylthian-4-one?
(5S)-5-(2,3-dimethylbut-3-enyl)-2,2-dimethylthian-4-one has a molecular weight of 225.38 g/mol, XLogP of 3.65, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-(2,3-dimethylbut-3-enyl)-2,2-dimethylthian-4-one is sourced from PubChem (CID 134855805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).