C13H6F3NO2 — CID 134855870
3-(trifluoromethyl)pyrano[3,2-f]quinolin-1-one (PubChem CID 134855870) has the molecular formula C13H6F3NO2 and a molecular weight of 265.19 g/mol. Its IUPAC name is 3-(trifluoromethyl)pyrano[3,2-f]quinolin-1-one.
| Compound Name | 3-(trifluoromethyl)pyrano[3,2-f]quinolin-1-one |
|---|---|
| PubChem CID | 134855870 |
| Molecular Formula | C13H6F3NO2 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 3-(trifluoromethyl)pyrano[3,2-f]quinolin-1-one |
| SMILES | O=c1cc(C(F)(F)F)oc2ccc3ncccc3c12 |
| InChI | InChI=1S/C13H6F3NO2/c14-13(15,16)11-6-9(18)12-7-2-1-5-17-8(7)3-4-10(12)19-11/h1-6H |
| InChIKey | XEFSSLHELZWGSK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|