C17H36OSi — CID 134855917
tert-butyl-dimethyl-[(Z,2R)-undec-3-en-2-yl]oxysilane (PubChem CID 134855917) has the molecular formula C17H36OSi and a molecular weight of 284.56 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z,2R)-undec-3-en-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(Z,2R)-undec-3-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 134855917 |
| Molecular Formula | C17H36OSi |
| Molecular Weight | 284.56 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | tert-butyl-dimethyl-[(Z,2R)-undec-3-en-2-yl]oxysilane |
| SMILES | CCCCCCC/C=C\[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H36OSi/c1-8-9-10-11-12-13-14-15-16(2)18-19(6,7)17(3,4)5/h14-16H,8-13H2,1-7H3/b15-14-/t16-/m1/s1 |
| InChIKey | STHVOFNRLIUZBW-YARYAAFXSA-N |
| XLogP | 6.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.56 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|