C16H22N2O — CID 134856070
(1S,2S,4R,9R)-15-methyl-11,15-diazatetracyclo[11.3.1.02,11.04,9]heptadeca-5,7-dien-17-one (PubChem CID 134856070) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is (1S,2S,4R,9R)-15-methyl-11,15-diazatetracyclo[11.3.1.02,11.04,9]heptadeca-5,7-dien-17-one.
| Compound Name | (1S,2S,4R,9R)-15-methyl-11,15-diazatetracyclo[11.3.1.02,11.04,9]heptadeca-5,7-dien-17-one |
|---|---|
| PubChem CID | 134856070 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (1S,2S,4R,9R)-15-methyl-11,15-diazatetracyclo[11.3.1.02,11.04,9]heptadeca-5,7-dien-17-one |
| SMILES | CN1CC2CN3C[C@@H]4C=CC=C[C@H]4C[C@H]3[C@H](C1)C2=O |
| InChI | InChI=1S/C16H22N2O/c1-17-7-13-9-18-8-12-5-3-2-4-11(12)6-15(18)14(10-17)16(13)19/h2-5,11-15H,6-10H2,1H3/t11-,12-,13?,14-,15-/m0/s1 |
| InChIKey | ANDKYPOKYFVVRP-CMTGQMGJSA-N |
| XLogP | 1.18 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |