C13H20O5 — CID 134856114
(3'aR,4R,7'aR)-2,2,2',2'-tetramethyl-7'-methylidenespiro[1,3-dioxolane-4,6'-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran] (PubChem CID 134856114) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is (3'aR,4R,7'aR)-2,2,2',2'-tetramethyl-7'-methylidenespiro[1,3-dioxolane-4,6'-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran].
| Compound Name | (3'aR,4R,7'aR)-2,2,2',2'-tetramethyl-7'-methylidenespiro[1,3-dioxolane-4,6'-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran] |
|---|---|
| PubChem CID | 134856114 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (3'aR,4R,7'aR)-2,2,2',2'-tetramethyl-7'-methylidenespiro[1,3-dioxolane-4,6'-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran] |
| SMILES | C=C1[C@H]2OC(C)(C)O[C@@H]2CO[C@]12COC(C)(C)O2 |
| InChI | InChI=1S/C13H20O5/c1-8-10-9(16-12(4,5)17-10)6-14-13(8)7-15-11(2,3)18-13/h9-10H,1,6-7H2,2-5H3/t9-,10-,13+/m1/s1 |
| InChIKey | NVXXMASOJRHAQO-BREBYQMCSA-N |
| XLogP | 1.57 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|