C16H22O3 — CID 134856157
7,7-dimethyl-3-pentyl-6,8-dihydrochromene-2,5-dione (PubChem CID 134856157) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 7,7-dimethyl-3-pentyl-6,8-dihydrochromene-2,5-dione.
| Compound Name | 7,7-dimethyl-3-pentyl-6,8-dihydrochromene-2,5-dione |
|---|---|
| PubChem CID | 134856157 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 7,7-dimethyl-3-pentyl-6,8-dihydrochromene-2,5-dione |
| SMILES | CCCCCc1cc2c(oc1=O)CC(C)(C)CC2=O |
| InChI | InChI=1S/C16H22O3/c1-4-5-6-7-11-8-12-13(17)9-16(2,3)10-14(12)19-15(11)18/h8H,4-7,9-10H2,1-3H3 |
| InChIKey | CGJFOHANMNLGJW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|