About (4R,6S)-3-but-3-enyl-4-ethenyl-6-phenyl-1,3-oxazinane
(4R,6S)-3-but-3-enyl-4-ethenyl-6-phenyl-1,3-oxazinane (PubChem CID 134856163) has the molecular formula C16H21NO
and a molecular weight of 243.35 g/mol. Its IUPAC name is (4R,6S)-3-but-3-enyl-4-ethenyl-6-phenyl-1,3-oxazinane.
Molecular Properties
| Compound Name | (4R,6S)-3-but-3-enyl-4-ethenyl-6-phenyl-1,3-oxazinane |
| PubChem CID | 134856163 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (4R,6S)-3-but-3-enyl-4-ethenyl-6-phenyl-1,3-oxazinane |
| SMILES | C=CCCN1CO[C@H](c2ccccc2)C[C@@H]1C=C |
| InChI | InChI=1S/C16H21NO/c1-3-5-11-17-13-18-16(12-15(17)4-2)14-9-7-6-8-10-14/h3-4,6-10,15-16H,1-2,5,11-13H2/t15-,16-/m0/s1 |
| InChIKey | YSXMZFNGASBOEZ-HOTGVXAUSA-N |
| XLogP | 3.54 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R,6S)-3-but-3-enyl-4-ethenyl-6-phenyl-1,3-oxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,6S)-3-but-3-enyl-4-ethenyl-6-phenyl-1,3-oxazinane?
The IUPAC name of (4R,6S)-3-but-3-enyl-4-ethenyl-6-phenyl-1,3-oxazinane (CID 134856163) is (4R,6S)-3-but-3-enyl-4-ethenyl-6-phenyl-1,3-oxazinane.
What is the SMILES notation for (4R,6S)-3-but-3-enyl-4-ethenyl-6-phenyl-1,3-oxazinane?
The canonical SMILES for (4R,6S)-3-but-3-enyl-4-ethenyl-6-phenyl-1,3-oxazinane is C=CCCN1CO[C@H](c2ccccc2)C[C@@H]1C=C.
What is the InChIKey of (4R,6S)-3-but-3-enyl-4-ethenyl-6-phenyl-1,3-oxazinane?
The InChIKey is YSXMZFNGASBOEZ-HOTGVXAUSA-N. The full InChI is InChI=1S/C16H21NO/c1-3-5-11-17-13-18-16(12-15(17)4-2)14-9-7-6-8-10-14/h3-4,6-10,15-16H,1-2,5,11-13H2/t15-,16-/m0/s1.
What are the key properties of (4R,6S)-3-but-3-enyl-4-ethenyl-6-phenyl-1,3-oxazinane?
(4R,6S)-3-but-3-enyl-4-ethenyl-6-phenyl-1,3-oxazinane has a molecular weight of 243.35 g/mol, XLogP of 3.54, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,6S)-3-but-3-enyl-4-ethenyl-6-phenyl-1,3-oxazinane is sourced from PubChem (CID 134856163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).