C12H20O5 — CID 134856258
[(4R,6S)-6-hydroxy-2,2,3a-trimethyl-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl]methyl acetate (PubChem CID 134856258) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is [(4R,6S)-6-hydroxy-2,2,3a-trimethyl-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl]methyl acetate.
| Compound Name | [(4R,6S)-6-hydroxy-2,2,3a-trimethyl-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl]methyl acetate |
|---|---|
| PubChem CID | 134856258 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | [(4R,6S)-6-hydroxy-2,2,3a-trimethyl-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C[C@H](O)C2OC(C)(C)OC21C |
| InChI | InChI=1S/C12H20O5/c1-7(13)15-6-8-5-9(14)10-12(8,4)17-11(2,3)16-10/h8-10,14H,5-6H2,1-4H3/t8-,9+,10?,12?/m1/s1 |
| InChIKey | UZNPWUSUZZJDKI-GHHKWEBWSA-N |
| XLogP | 0.84 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |