About [(2R,3S)-3-acetyloxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl] but-2-ynoate
[(2R,3S)-3-acetyloxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl] but-2-ynoate (PubChem CID 134856293) has the molecular formula C12H12O5
and a molecular weight of 236.22 g/mol. Its IUPAC name is [(2R,3S)-3-acetyloxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl] but-2-ynoate.
Molecular Properties
| Compound Name | [(2R,3S)-3-acetyloxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl] but-2-ynoate |
| PubChem CID | 134856293 |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | [(2R,3S)-3-acetyloxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl] but-2-ynoate |
| SMILES | CC#CC(=O)O[C@@H]1C2C=CC(O2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C12H12O5/c1-3-4-10(14)17-12-9-6-5-8(16-9)11(12)15-7(2)13/h5-6,8-9,11-12H,1-2H3/t8?,9?,11-,12+/m0/s1 |
| InChIKey | CQXXQZZUWAWVEC-CHCPCTANSA-N |
| XLogP | 0.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3S)-3-acetyloxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl] but-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3S)-3-acetyloxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl] but-2-ynoate?
The IUPAC name of [(2R,3S)-3-acetyloxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl] but-2-ynoate (CID 134856293) is [(2R,3S)-3-acetyloxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl] but-2-ynoate.
What is the SMILES notation for [(2R,3S)-3-acetyloxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl] but-2-ynoate?
The canonical SMILES for [(2R,3S)-3-acetyloxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl] but-2-ynoate is CC#CC(=O)O[C@@H]1C2C=CC(O2)[C@@H]1OC(C)=O.
What is the InChIKey of [(2R,3S)-3-acetyloxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl] but-2-ynoate?
The InChIKey is CQXXQZZUWAWVEC-CHCPCTANSA-N. The full InChI is InChI=1S/C12H12O5/c1-3-4-10(14)17-12-9-6-5-8(16-9)11(12)15-7(2)13/h5-6,8-9,11-12H,1-2H3/t8?,9?,11-,12+/m0/s1.
What are the key properties of [(2R,3S)-3-acetyloxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl] but-2-ynoate?
[(2R,3S)-3-acetyloxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl] but-2-ynoate has a molecular weight of 236.22 g/mol, XLogP of 0.19, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3S)-3-acetyloxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl] but-2-ynoate is sourced from PubChem (CID 134856293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).