C17H15BrCl2N2 — CID 13485631
8-bromo-3-chloro-6-(2-chlorophenyl)-1-methyl-3,4-dihydro-2H-1,5-benzodiazocine (PubChem CID 13485631) has the molecular formula C17H15BrCl2N2 and a molecular weight of 398.13 g/mol. Its IUPAC name is 8-bromo-3-chloro-6-(2-chlorophenyl)-1-methyl-3,4-dihydro-2H-1,5-benzodiazocine.
| Compound Name | 8-bromo-3-chloro-6-(2-chlorophenyl)-1-methyl-3,4-dihydro-2H-1,5-benzodiazocine |
|---|---|
| PubChem CID | 13485631 |
| Molecular Formula | C17H15BrCl2N2 |
| Molecular Weight | 398.13 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | 8-bromo-3-chloro-6-(2-chlorophenyl)-1-methyl-3,4-dihydro-2H-1,5-benzodiazocine |
| SMILES | CN1CC(Cl)C/N=C(/c2ccccc2Cl)c2cc(Br)ccc21 |
| InChI | InChI=1S/C17H15BrCl2N2/c1-22-10-12(19)9-21-17(13-4-2-3-5-15(13)20)14-8-11(18)6-7-16(14)22/h2-8,12H,9-10H2,1H3/b21-17- |
| InChIKey | RTEGRSZGVFXLMA-FXBPSFAMSA-N |
| XLogP | 5.00 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.13 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|