About ethyl (1R,6S)-5,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylate
ethyl (1R,6S)-5,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 134856323) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is ethyl (1R,6S)-5,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylate.
Molecular Properties
| Compound Name | ethyl (1R,6S)-5,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylate |
| PubChem CID | 134856323 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | ethyl (1R,6S)-5,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)C=CC(C)[C@@H]1C |
| InChI | InChI=1S/C11H16O3/c1-4-14-11(13)10-8(3)7(2)5-6-9(10)12/h5-8,10H,4H2,1-3H3/t7?,8-,10+/m0/s1 |
| InChIKey | KDMQLFJUTWKGPA-DXEWVWIPSA-N |
| XLogP | 1.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl (1R,6S)-5,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (1R,6S)-5,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylate?
The IUPAC name of ethyl (1R,6S)-5,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylate (CID 134856323) is ethyl (1R,6S)-5,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylate.
What is the SMILES notation for ethyl (1R,6S)-5,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylate?
The canonical SMILES for ethyl (1R,6S)-5,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylate is CCOC(=O)[C@H]1C(=O)C=CC(C)[C@@H]1C.
What is the InChIKey of ethyl (1R,6S)-5,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylate?
The InChIKey is KDMQLFJUTWKGPA-DXEWVWIPSA-N. The full InChI is InChI=1S/C11H16O3/c1-4-14-11(13)10-8(3)7(2)5-6-9(10)12/h5-8,10H,4H2,1-3H3/t7?,8-,10+/m0/s1.
What are the key properties of ethyl (1R,6S)-5,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylate?
ethyl (1R,6S)-5,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylate has a molecular weight of 196.25 g/mol, XLogP of 1.58, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (1R,6S)-5,6-dimethyl-2-oxocyclohex-3-ene-1-carboxylate is sourced from PubChem (CID 134856323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).