C7H13NO5 — CID 134856365
(2R,3R)-2,3-dihydroxy-N-methoxy-N-methyl-4-oxopentanamide (PubChem CID 134856365) has the molecular formula C7H13NO5 and a molecular weight of 191.18 g/mol. Its IUPAC name is (2R,3R)-2,3-dihydroxy-N-methoxy-N-methyl-4-oxopentanamide.
| Compound Name | (2R,3R)-2,3-dihydroxy-N-methoxy-N-methyl-4-oxopentanamide |
|---|---|
| PubChem CID | 134856365 |
| Molecular Formula | C7H13NO5 |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | (2R,3R)-2,3-dihydroxy-N-methoxy-N-methyl-4-oxopentanamide |
| SMILES | CON(C)C(=O)[C@H](O)[C@@H](O)C(C)=O |
| InChI | InChI=1S/C7H13NO5/c1-4(9)5(10)6(11)7(12)8(2)13-3/h5-6,10-11H,1-3H3/t5-,6+/m0/s1 |
| InChIKey | DTPWMCRXSUKNTN-NTSWFWBYSA-N |
| XLogP | -1.68 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.18 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|