C11H18O4 — CID 134856413
2-[(3S,5R)-2,3,5-trimethyl-6-oxooxan-2-yl]propanoic acid (PubChem CID 134856413) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is 2-[(3S,5R)-2,3,5-trimethyl-6-oxooxan-2-yl]propanoic acid.
| Compound Name | 2-[(3S,5R)-2,3,5-trimethyl-6-oxooxan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 134856413 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 2-[(3S,5R)-2,3,5-trimethyl-6-oxooxan-2-yl]propanoic acid |
| SMILES | CC(C(=O)O)C1(C)OC(=O)[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C11H18O4/c1-6-5-7(2)11(4,15-10(6)14)8(3)9(12)13/h6-8H,5H2,1-4H3,(H,12,13)/t6-,7+,8?,11?/m1/s1 |
| InChIKey | YZRHDIIRSDCUHJ-GIFGPCTOSA-N |
| XLogP | 1.68 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |