C11H18F3O4P — CID 134856419
2-[(Z)-1-diethoxyphosphoryl-3,3,3-trifluoroprop-1-en-2-yl]oxolane (PubChem CID 134856419) has the molecular formula C11H18F3O4P and a molecular weight of 302.23 g/mol. Its IUPAC name is 2-[(Z)-1-diethoxyphosphoryl-3,3,3-trifluoroprop-1-en-2-yl]oxolane.
| Compound Name | 2-[(Z)-1-diethoxyphosphoryl-3,3,3-trifluoroprop-1-en-2-yl]oxolane |
|---|---|
| PubChem CID | 134856419 |
| Molecular Formula | C11H18F3O4P |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-[(Z)-1-diethoxyphosphoryl-3,3,3-trifluoroprop-1-en-2-yl]oxolane |
| SMILES | CCOP(=O)(/C=C(/C1CCCO1)C(F)(F)F)OCC |
| InChI | InChI=1S/C11H18F3O4P/c1-3-17-19(15,18-4-2)8-9(11(12,13)14)10-6-5-7-16-10/h8,10H,3-7H2,1-2H3/b9-8- |
| InChIKey | DECWHUXPCPHPCV-HJWRWDBZSA-N |
| XLogP | 3.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|