About cis-(1S,2R)-4,4-bis(hydroxymethyl)-2-(4-pentyltriazol-1-yl)cyclopentan-1-ol
cis-(1S,2R)-4,4-bis(hydroxymethyl)-2-(4-pentyltriazol-1-yl)cyclopentan-1-ol (PubChem CID 134856440) has the molecular formula C14H25N3O3
and a molecular weight of 283.37 g/mol. Its IUPAC name is cis-(1S,2R)-4,4-bis(hydroxymethyl)-2-(4-pentyltriazol-1-yl)cyclopentan-1-ol.
Molecular Properties
| Compound Name | cis-(1S,2R)-4,4-bis(hydroxymethyl)-2-(4-pentyltriazol-1-yl)cyclopentan-1-ol |
| PubChem CID | 134856440 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | cis-(1S,2R)-4,4-bis(hydroxymethyl)-2-(4-pentyltriazol-1-yl)cyclopentan-1-ol |
| SMILES | CCCCCc1cn([C@@H]2CC(CO)(CO)C[C@@H]2O)nn1 |
| InChI | InChI=1S/C14H25N3O3/c1-2-3-4-5-11-8-17(16-15-11)12-6-14(9-18,10-19)7-13(12)20/h8,12-13,18-20H,2-7,9-10H2,1H3/t12-,13+/m1/s1 |
| InChIKey | XJYRKSZWOHNLFU-OLZOCXBDSA-N |
| XLogP | 0.68 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cis-(1S,2R)-4,4-bis(hydroxymethyl)-2-(4-pentyltriazol-1-yl)cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-4,4-bis(hydroxymethyl)-2-(4-pentyltriazol-1-yl)cyclopentan-1-ol?
The IUPAC name of cis-(1S,2R)-4,4-bis(hydroxymethyl)-2-(4-pentyltriazol-1-yl)cyclopentan-1-ol (CID 134856440) is cis-(1S,2R)-4,4-bis(hydroxymethyl)-2-(4-pentyltriazol-1-yl)cyclopentan-1-ol.
What is the SMILES notation for cis-(1S,2R)-4,4-bis(hydroxymethyl)-2-(4-pentyltriazol-1-yl)cyclopentan-1-ol?
The canonical SMILES for cis-(1S,2R)-4,4-bis(hydroxymethyl)-2-(4-pentyltriazol-1-yl)cyclopentan-1-ol is CCCCCc1cn([C@@H]2CC(CO)(CO)C[C@@H]2O)nn1.
What is the InChIKey of cis-(1S,2R)-4,4-bis(hydroxymethyl)-2-(4-pentyltriazol-1-yl)cyclopentan-1-ol?
The InChIKey is XJYRKSZWOHNLFU-OLZOCXBDSA-N. The full InChI is InChI=1S/C14H25N3O3/c1-2-3-4-5-11-8-17(16-15-11)12-6-14(9-18,10-19)7-13(12)20/h8,12-13,18-20H,2-7,9-10H2,1H3/t12-,13+/m1/s1.
What are the key properties of cis-(1S,2R)-4,4-bis(hydroxymethyl)-2-(4-pentyltriazol-1-yl)cyclopentan-1-ol?
cis-(1S,2R)-4,4-bis(hydroxymethyl)-2-(4-pentyltriazol-1-yl)cyclopentan-1-ol has a molecular weight of 283.37 g/mol, XLogP of 0.68, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-4,4-bis(hydroxymethyl)-2-(4-pentyltriazol-1-yl)cyclopentan-1-ol is sourced from PubChem (CID 134856440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).