About (3R)-1,1-difluorohept-6-ene-1,3-diol;rutherfordium
(3R)-1,1-difluorohept-6-ene-1,3-diol;rutherfordium (PubChem CID 134856462) has the molecular formula C7H12F2O2Rf
and a molecular weight of 433.17 g/mol. Its IUPAC name is (3R)-1,1-difluorohept-6-ene-1,3-diol;rutherfordium.
Molecular Properties
| Compound Name | (3R)-1,1-difluorohept-6-ene-1,3-diol;rutherfordium |
| PubChem CID | 134856462 |
| Molecular Formula | C7H12F2O2Rf |
| Molecular Weight | 433.17 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | (3R)-1,1-difluorohept-6-ene-1,3-diol;rutherfordium |
| SMILES | C=CCC[C@@H](O)CC(O)(F)F.[Rf] |
| InChI | InChI=1S/C7H12F2O2.Rf/c1-2-3-4-6(10)5-7(8,9)11;/h2,6,10-11H,1,3-5H2;/t6-;/m1./s1 |
| InChIKey | ZFTAKAFVVSXGKM-FYZOBXCZSA-N |
| XLogP | 1.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.17 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-1,1-difluorohept-6-ene-1,3-diol;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1,1-difluorohept-6-ene-1,3-diol;rutherfordium?
The IUPAC name of (3R)-1,1-difluorohept-6-ene-1,3-diol;rutherfordium (CID 134856462) is (3R)-1,1-difluorohept-6-ene-1,3-diol;rutherfordium.
What is the SMILES notation for (3R)-1,1-difluorohept-6-ene-1,3-diol;rutherfordium?
The canonical SMILES for (3R)-1,1-difluorohept-6-ene-1,3-diol;rutherfordium is C=CCC[C@@H](O)CC(O)(F)F.[Rf].
What is the InChIKey of (3R)-1,1-difluorohept-6-ene-1,3-diol;rutherfordium?
The InChIKey is ZFTAKAFVVSXGKM-FYZOBXCZSA-N. The full InChI is InChI=1S/C7H12F2O2.Rf/c1-2-3-4-6(10)5-7(8,9)11;/h2,6,10-11H,1,3-5H2;/t6-;/m1./s1.
What are the key properties of (3R)-1,1-difluorohept-6-ene-1,3-diol;rutherfordium?
(3R)-1,1-difluorohept-6-ene-1,3-diol;rutherfordium has a molecular weight of 433.17 g/mol, XLogP of 1.29, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1,1-difluorohept-6-ene-1,3-diol;rutherfordium is sourced from PubChem (CID 134856462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).