C11H18O6 — CID 134856655
(3R)-3-[(3aS,4R,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3-hydroxypropanal (PubChem CID 134856655) has the molecular formula C11H18O6 and a molecular weight of 246.26 g/mol. Its IUPAC name is (3R)-3-[(3aS,4R,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3-hydroxypropanal.
| Compound Name | (3R)-3-[(3aS,4R,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3-hydroxypropanal |
|---|---|
| PubChem CID | 134856655 |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | (3R)-3-[(3aS,4R,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-3-hydroxypropanal |
| SMILES | CO[C@@H]1O[C@H]([C@H](O)CC=O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C11H18O6/c1-11(2)16-8-7(6(13)4-5-12)15-10(14-3)9(8)17-11/h5-10,13H,4H2,1-3H3/t6-,7-,8+,9+,10-/m1/s1 |
| InChIKey | OTXBYSUORGPAFK-FHNUBNKASA-N |
| XLogP | -0.17 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|