C14H24O — CID 134856694
6-(1-ethoxypentyl)-1-methylcyclohexa-1,3-diene (PubChem CID 134856694) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 6-(1-ethoxypentyl)-1-methylcyclohexa-1,3-diene.
| Compound Name | 6-(1-ethoxypentyl)-1-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 134856694 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 6-(1-ethoxypentyl)-1-methylcyclohexa-1,3-diene |
| SMILES | CCCCC(OCC)C1CC=CC=C1C |
| InChI | InChI=1S/C14H24O/c1-4-6-11-14(15-5-2)13-10-8-7-9-12(13)3/h7-9,13-14H,4-6,10-11H2,1-3H3 |
| InChIKey | RFLOQUOAFLFAMB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |