C16H27NO2Si — CID 134856695
6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6,7,8-tetrahydroquinolin-8-ol (PubChem CID 134856695) has the molecular formula C16H27NO2Si and a molecular weight of 293.48 g/mol. Its IUPAC name is 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6,7,8-tetrahydroquinolin-8-ol.
| Compound Name | 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6,7,8-tetrahydroquinolin-8-ol |
|---|---|
| PubChem CID | 134856695 |
| Molecular Formula | C16H27NO2Si |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6,7,8-tetrahydroquinolin-8-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCC1Cc2cccnc2C(O)C1 |
| InChI | InChI=1S/C16H27NO2Si/c1-16(2,3)20(4,5)19-11-12-9-13-7-6-8-17-15(13)14(18)10-12/h6-8,12,14,18H,9-11H2,1-5H3 |
| InChIKey | PFELECLNXOEZEP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|