C32H41NO16S — CID 134856750
[(3S,6S)-6-[(3S,6S)-5-acetamido-4-acetyloxy-2-(acetyloxymethyl)-6-phenylsulfanyloxan-3-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate (PubChem CID 134856750) has the molecular formula C32H41NO16S and a molecular weight of 727.74 g/mol. Its IUPAC name is [(3S,6S)-6-[(3S,6S)-5-acetamido-4-acetyloxy-2-(acetyloxymethyl)-6-phenylsulfanyloxan-3-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate.
| Compound Name | [(3S,6S)-6-[(3S,6S)-5-acetamido-4-acetyloxy-2-(acetyloxymethyl)-6-phenylsulfanyloxan-3-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134856750 |
| Molecular Formula | C32H41NO16S |
| Molecular Weight | 727.74 g/mol |
| Exact Mass | 727.21 |
| IUPAC Name | [(3S,6S)-6-[(3S,6S)-5-acetamido-4-acetyloxy-2-(acetyloxymethyl)-6-phenylsulfanyloxan-3-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)NC1C(OC(C)=O)[C@H](O[C@@H]2OC(COC(C)=O)[C@H](OC(C)=O)C(OC(C)=O)C2OC(C)=O)C(COC(C)=O)O[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C32H41NO16S/c1-15(34)33-25-28(44-19(5)38)26(24(14-42-17(3)36)48-32(25)50-22-11-9-8-10-12-22)49-31-30(46-21(7)40)29(45-20(6)39)27(43-18(4)37)23(47-31)13-41-16(2)35/h8-12,23-32H,13-14H2,1-7H3,(H,33,34)/t23?,24?,25?,26-,27+,28?,29?,30?,31+,32+/m1/s1 |
| InChIKey | UZKYMIZWGCYTGX-MTHGFGPHSA-N |
| XLogP | 0.97 |
| TPSA | 214.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.74 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|