C20H38O2Si — CID 134856772
(4R,5E,7Z)-4-[tert-butyl(dimethyl)silyl]oxy-8-cyclohexylocta-5,7-dien-2-ol (PubChem CID 134856772) has the molecular formula C20H38O2Si and a molecular weight of 338.61 g/mol. Its IUPAC name is (4R,5E,7Z)-4-[tert-butyl(dimethyl)silyl]oxy-8-cyclohexylocta-5,7-dien-2-ol.
| Compound Name | (4R,5E,7Z)-4-[tert-butyl(dimethyl)silyl]oxy-8-cyclohexylocta-5,7-dien-2-ol |
|---|---|
| PubChem CID | 134856772 |
| Molecular Formula | C20H38O2Si |
| Molecular Weight | 338.61 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | (4R,5E,7Z)-4-[tert-butyl(dimethyl)silyl]oxy-8-cyclohexylocta-5,7-dien-2-ol |
| SMILES | CC(O)C[C@H](/C=C/C=C\C1CCCCC1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O2Si/c1-17(21)16-19(22-23(5,6)20(2,3)4)15-11-10-14-18-12-8-7-9-13-18/h10-11,14-15,17-19,21H,7-9,12-13,16H2,1-6H3/b14-10-,15-11+/t17?,19-/m0/s1 |
| InChIKey | FDFCXFJOCKNCNI-JGYMNBDOSA-N |
| XLogP | 5.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.61 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|