C17H22O4 — CID 134857059
2-[(1R,6S,8aR)-6-acetyloxy-4,7-dimethyl-1,2,4a,5,6,8a-hexahydronaphthalen-1-yl]prop-2-enoic acid (PubChem CID 134857059) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-[(1R,6S,8aR)-6-acetyloxy-4,7-dimethyl-1,2,4a,5,6,8a-hexahydronaphthalen-1-yl]prop-2-enoic acid.
| Compound Name | 2-[(1R,6S,8aR)-6-acetyloxy-4,7-dimethyl-1,2,4a,5,6,8a-hexahydronaphthalen-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 134857059 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-[(1R,6S,8aR)-6-acetyloxy-4,7-dimethyl-1,2,4a,5,6,8a-hexahydronaphthalen-1-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)[C@@H]1CC=C(C)C2C[C@H](OC(C)=O)C(C)=C[C@H]21 |
| InChI | InChI=1S/C17H22O4/c1-9-5-6-13(11(3)17(19)20)15-7-10(2)16(8-14(9)15)21-12(4)18/h5,7,13-16H,3,6,8H2,1-2,4H3,(H,19,20)/t13-,14?,15-,16-/m0/s1 |
| InChIKey | JSWWHFZVXZYITP-PBBYBOOSSA-N |
| XLogP | 3.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|