About 7-bromo-5-(2,6-difluorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one
7-bromo-5-(2,6-difluorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one (PubChem CID 13485706) has the molecular formula C16H11BrF2N2O
and a molecular weight of 365.18 g/mol. Its IUPAC name is 7-bromo-5-(2,6-difluorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 7-bromo-5-(2,6-difluorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one |
| PubChem CID | 13485706 |
| Molecular Formula | C16H11BrF2N2O |
| Molecular Weight | 365.18 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | 7-bromo-5-(2,6-difluorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one |
| SMILES | CN1C(=O)CN=C(c2c(F)cccc2F)c2cc(Br)ccc21 |
| InChI | InChI=1S/C16H11BrF2N2O/c1-21-13-6-5-9(17)7-10(13)16(20-8-14(21)22)15-11(18)3-2-4-12(15)19/h2-7H,8H2,1H3 |
| InChIKey | XXPNMKPARHVBIY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.18 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-5-(2,6-difluorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-5-(2,6-difluorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one?
The IUPAC name of 7-bromo-5-(2,6-difluorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one (CID 13485706) is 7-bromo-5-(2,6-difluorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one.
What is the SMILES notation for 7-bromo-5-(2,6-difluorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one?
The canonical SMILES for 7-bromo-5-(2,6-difluorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one is CN1C(=O)CN=C(c2c(F)cccc2F)c2cc(Br)ccc21.
What is the InChIKey of 7-bromo-5-(2,6-difluorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one?
The InChIKey is XXPNMKPARHVBIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11BrF2N2O/c1-21-13-6-5-9(17)7-10(13)16(20-8-14(21)22)15-11(18)3-2-4-12(15)19/h2-7H,8H2,1H3.
What are the key properties of 7-bromo-5-(2,6-difluorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one?
7-bromo-5-(2,6-difluorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one has a molecular weight of 365.18 g/mol, XLogP of 3.54, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-5-(2,6-difluorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one is sourced from PubChem (CID 13485706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).