About 2-chloro-6-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pyridine
2-chloro-6-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pyridine (PubChem CID 134857061) has the molecular formula C12H17ClN2
and a molecular weight of 224.73 g/mol. Its IUPAC name is 2-chloro-6-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pyridine.
Molecular Properties
| Compound Name | 2-chloro-6-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pyridine |
| PubChem CID | 134857061 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-chloro-6-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pyridine |
| SMILES | C[C@@H]1CCC[C@H](C)N1c1cccc(Cl)n1 |
| InChI | InChI=1S/C12H17ClN2/c1-9-5-3-6-10(2)15(9)12-8-4-7-11(13)14-12/h4,7-10H,3,5-6H2,1-2H3/t9-,10+ |
| InChIKey | DMFLFABWSKWRHX-AOOOYVTPSA-N |
| XLogP | 3.50 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pyridine?
The IUPAC name of 2-chloro-6-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pyridine (CID 134857061) is 2-chloro-6-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pyridine.
What is the SMILES notation for 2-chloro-6-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pyridine?
The canonical SMILES for 2-chloro-6-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pyridine is C[C@@H]1CCC[C@H](C)N1c1cccc(Cl)n1.
What is the InChIKey of 2-chloro-6-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pyridine?
The InChIKey is DMFLFABWSKWRHX-AOOOYVTPSA-N. The full InChI is InChI=1S/C12H17ClN2/c1-9-5-3-6-10(2)15(9)12-8-4-7-11(13)14-12/h4,7-10H,3,5-6H2,1-2H3/t9-,10+.
What are the key properties of 2-chloro-6-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pyridine?
2-chloro-6-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pyridine has a molecular weight of 224.73 g/mol, XLogP of 3.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-[(2R,6S)-2,6-dimethylpiperidin-1-yl]pyridine is sourced from PubChem (CID 134857061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).