C11H14O2 — CID 134857181
3-methylidene-4,5-bis(prop-2-enyl)oxolan-2-one (PubChem CID 134857181) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 3-methylidene-4,5-bis(prop-2-enyl)oxolan-2-one.
| Compound Name | 3-methylidene-4,5-bis(prop-2-enyl)oxolan-2-one |
|---|---|
| PubChem CID | 134857181 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 3-methylidene-4,5-bis(prop-2-enyl)oxolan-2-one |
| SMILES | C=CCC1OC(=O)C(=C)C1CC=C |
| InChI | InChI=1S/C11H14O2/c1-4-6-9-8(3)11(12)13-10(9)7-5-2/h4-5,9-10H,1-3,6-7H2 |
| InChIKey | VYVODKKEKZRCRS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|