C15H23N3O — CID 134857323
(Z)-3-(dimethylamino)-N,N-dimethyl-3-(4,5,6,7-tetrahydro-1H-indol-2-yl)prop-2-enamide (PubChem CID 134857323) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is (Z)-3-(dimethylamino)-N,N-dimethyl-3-(4,5,6,7-tetrahydro-1H-indol-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-(dimethylamino)-N,N-dimethyl-3-(4,5,6,7-tetrahydro-1H-indol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 134857323 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | (Z)-3-(dimethylamino)-N,N-dimethyl-3-(4,5,6,7-tetrahydro-1H-indol-2-yl)prop-2-enamide |
| SMILES | CN(C)C(=O)/C=C(/c1cc2c([nH]1)CCCC2)N(C)C |
| InChI | InChI=1S/C15H23N3O/c1-17(2)14(10-15(19)18(3)4)13-9-11-7-5-6-8-12(11)16-13/h9-10,16H,5-8H2,1-4H3/b14-10- |
| InChIKey | XRXRTUHCQZWWHK-UVTDQMKNSA-N |
| XLogP | 1.88 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|