About ethyl (3R)-3-(benzylideneamino)-4,4,4-trifluorobutanoate
ethyl (3R)-3-(benzylideneamino)-4,4,4-trifluorobutanoate (PubChem CID 134857525) has the molecular formula C13H14F3NO2
and a molecular weight of 273.25 g/mol. Its IUPAC name is ethyl (3R)-3-(benzylideneamino)-4,4,4-trifluorobutanoate.
Molecular Properties
| Compound Name | ethyl (3R)-3-(benzylideneamino)-4,4,4-trifluorobutanoate |
| PubChem CID | 134857525 |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | ethyl (3R)-3-(benzylideneamino)-4,4,4-trifluorobutanoate |
| SMILES | CCOC(=O)C[C@@H](/N=C/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H14F3NO2/c1-2-19-12(18)8-11(13(14,15)16)17-9-10-6-4-3-5-7-10/h3-7,9,11H,2,8H2,1H3/b17-9+/t11-/m1/s1 |
| InChIKey | JFEKZLNPPRUFFJ-LBFZPMSMSA-N |
| XLogP | 2.99 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (3R)-3-(benzylideneamino)-4,4,4-trifluorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3R)-3-(benzylideneamino)-4,4,4-trifluorobutanoate?
The IUPAC name of ethyl (3R)-3-(benzylideneamino)-4,4,4-trifluorobutanoate (CID 134857525) is ethyl (3R)-3-(benzylideneamino)-4,4,4-trifluorobutanoate.
What is the SMILES notation for ethyl (3R)-3-(benzylideneamino)-4,4,4-trifluorobutanoate?
The canonical SMILES for ethyl (3R)-3-(benzylideneamino)-4,4,4-trifluorobutanoate is CCOC(=O)C[C@@H](/N=C/c1ccccc1)C(F)(F)F.
What is the InChIKey of ethyl (3R)-3-(benzylideneamino)-4,4,4-trifluorobutanoate?
The InChIKey is JFEKZLNPPRUFFJ-LBFZPMSMSA-N. The full InChI is InChI=1S/C13H14F3NO2/c1-2-19-12(18)8-11(13(14,15)16)17-9-10-6-4-3-5-7-10/h3-7,9,11H,2,8H2,1H3/b17-9+/t11-/m1/s1.
What are the key properties of ethyl (3R)-3-(benzylideneamino)-4,4,4-trifluorobutanoate?
ethyl (3R)-3-(benzylideneamino)-4,4,4-trifluorobutanoate has a molecular weight of 273.25 g/mol, XLogP of 2.99, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3R)-3-(benzylideneamino)-4,4,4-trifluorobutanoate is sourced from PubChem (CID 134857525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).