C13H14F3NO2 — CID 134857525
ethyl (3R)-3-(benzylideneamino)-4,4,4-trifluorobutanoate (PubChem CID 134857525) has the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. Its IUPAC name is ethyl (3R)-3-(benzylideneamino)-4,4,4-trifluorobutanoate.
| Compound Name | ethyl (3R)-3-(benzylideneamino)-4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 134857525 |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | ethyl (3R)-3-(benzylideneamino)-4,4,4-trifluorobutanoate |
| SMILES | CCOC(=O)C[C@@H](/N=C/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H14F3NO2/c1-2-19-12(18)8-11(13(14,15)16)17-9-10-6-4-3-5-7-10/h3-7,9,11H,2,8H2,1H3/b17-9+/t11-/m1/s1 |
| InChIKey | JFEKZLNPPRUFFJ-LBFZPMSMSA-N |
| XLogP | 2.99 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|