About (E)-7,7-diethoxyhept-2-en-5-yn-4-one
(E)-7,7-diethoxyhept-2-en-5-yn-4-one (PubChem CID 134857691) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is (E)-7,7-diethoxyhept-2-en-5-yn-4-one.
Molecular Properties
| Compound Name | (E)-7,7-diethoxyhept-2-en-5-yn-4-one |
| PubChem CID | 134857691 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (E)-7,7-diethoxyhept-2-en-5-yn-4-one |
| SMILES | C/C=C/C(=O)C#CC(OCC)OCC |
| InChI | InChI=1S/C11H16O3/c1-4-7-10(12)8-9-11(13-5-2)14-6-3/h4,7,11H,5-6H2,1-3H3/b7-4+ |
| InChIKey | VEXJOWYDBPPENC-QPJJXVBHSA-N |
| XLogP | 1.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-7,7-diethoxyhept-2-en-5-yn-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-7,7-diethoxyhept-2-en-5-yn-4-one?
The IUPAC name of (E)-7,7-diethoxyhept-2-en-5-yn-4-one (CID 134857691) is (E)-7,7-diethoxyhept-2-en-5-yn-4-one.
What is the SMILES notation for (E)-7,7-diethoxyhept-2-en-5-yn-4-one?
The canonical SMILES for (E)-7,7-diethoxyhept-2-en-5-yn-4-one is C/C=C/C(=O)C#CC(OCC)OCC.
What is the InChIKey of (E)-7,7-diethoxyhept-2-en-5-yn-4-one?
The InChIKey is VEXJOWYDBPPENC-QPJJXVBHSA-N. The full InChI is InChI=1S/C11H16O3/c1-4-7-10(12)8-9-11(13-5-2)14-6-3/h4,7,11H,5-6H2,1-3H3/b7-4+.
What are the key properties of (E)-7,7-diethoxyhept-2-en-5-yn-4-one?
(E)-7,7-diethoxyhept-2-en-5-yn-4-one has a molecular weight of 196.25 g/mol, XLogP of 1.53, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-7,7-diethoxyhept-2-en-5-yn-4-one is sourced from PubChem (CID 134857691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).