C13H28O3Si — CID 134857731
(2R,4S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyloxan-4-ol (PubChem CID 134857731) has the molecular formula C13H28O3Si and a molecular weight of 260.45 g/mol. Its IUPAC name is (2R,4S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyloxan-4-ol.
| Compound Name | (2R,4S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyloxan-4-ol |
|---|---|
| PubChem CID | 134857731 |
| Molecular Formula | C13H28O3Si |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (2R,4S,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyloxan-4-ol |
| SMILES | C[C@@H]1C[C@H](O)C[C@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C13H28O3Si/c1-10-7-11(14)8-12(16-10)9-15-17(5,6)13(2,3)4/h10-12,14H,7-9H2,1-6H3/t10-,11+,12-/m1/s1 |
| InChIKey | AHGREGXVKWOLQK-GRYCIOLGSA-N |
| XLogP | 2.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|