C9H18O4 — CID 134857736
(2R,3R,5S)-2,3-dimethoxy-2,3,5-trimethyl-1,4-dioxane (PubChem CID 134857736) has the molecular formula C9H18O4 and a molecular weight of 190.24 g/mol. Its IUPAC name is (2R,3R,5S)-2,3-dimethoxy-2,3,5-trimethyl-1,4-dioxane.
| Compound Name | (2R,3R,5S)-2,3-dimethoxy-2,3,5-trimethyl-1,4-dioxane |
|---|---|
| PubChem CID | 134857736 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | (2R,3R,5S)-2,3-dimethoxy-2,3,5-trimethyl-1,4-dioxane |
| SMILES | CO[C@]1(C)OC[C@H](C)O[C@@]1(C)OC |
| InChI | InChI=1S/C9H18O4/c1-7-6-12-8(2,10-4)9(3,11-5)13-7/h7H,6H2,1-5H3/t7-,8+,9+/m0/s1 |
| InChIKey | PGXBLMVXWCVYRU-DJLDLDEBSA-N |
| XLogP | 1.15 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |