C12H22O2Si — CID 134857740
tert-butyl-[(2R,3S,5S)-2-ethynyl-5-tritiooxolan-3-yl]oxy-dimethylsilane (PubChem CID 134857740) has the molecular formula C12H22O2Si and a molecular weight of 228.40 g/mol. Its IUPAC name is tert-butyl-[(2R,3S,5S)-2-ethynyl-5-tritiooxolan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3S,5S)-2-ethynyl-5-tritiooxolan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134857740 |
| Molecular Formula | C12H22O2Si |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | tert-butyl-[(2R,3S,5S)-2-ethynyl-5-tritiooxolan-3-yl]oxy-dimethylsilane |
| SMILES | [3H][C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C#C)O1 |
| InChI | InChI=1S/C12H22O2Si/c1-7-10-11(8-9-13-10)14-15(5,6)12(2,3)4/h1,10-11H,8-9H2,2-6H3/t10-,11+/m1/s1/i9T/t9-,10+,11-/m0 |
| InChIKey | LPTYCTLUHIUCSE-GVCBLXQKSA-N |
| XLogP | 2.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|