C11H20Si — CID 134857856
(2,4-dimethylcyclohexa-1,4-dien-1-yl)-trimethylsilane (PubChem CID 134857856) has the molecular formula C11H20Si and a molecular weight of 180.37 g/mol. Its IUPAC name is (2,4-dimethylcyclohexa-1,4-dien-1-yl)-trimethylsilane.
| Compound Name | (2,4-dimethylcyclohexa-1,4-dien-1-yl)-trimethylsilane |
|---|---|
| PubChem CID | 134857856 |
| Molecular Formula | C11H20Si |
| Molecular Weight | 180.37 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (2,4-dimethylcyclohexa-1,4-dien-1-yl)-trimethylsilane |
| SMILES | CC1=CCC([Si](C)(C)C)=C(C)C1 |
| InChI | InChI=1S/C11H20Si/c1-9-6-7-11(10(2)8-9)12(3,4)5/h6H,7-8H2,1-5H3 |
| InChIKey | LZPRSHZYCTWFOQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|