About (1S,2R,3S)-3-amino-2-methylcyclohexan-1-ol;hydrochloride
(1S,2R,3S)-3-amino-2-methylcyclohexan-1-ol;hydrochloride (PubChem CID 134858014) has the molecular formula C7H16ClNO
and a molecular weight of 165.66 g/mol. Its IUPAC name is (1S,2R,3S)-3-amino-2-methylcyclohexan-1-ol;hydrochloride.
Molecular Properties
| Compound Name | (1S,2R,3S)-3-amino-2-methylcyclohexan-1-ol;hydrochloride |
| PubChem CID | 134858014 |
| Molecular Formula | C7H16ClNO |
| Molecular Weight | 165.66 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | (1S,2R,3S)-3-amino-2-methylcyclohexan-1-ol;hydrochloride |
| SMILES | C[C@@H]1[C@@H](N)CCC[C@@H]1O.Cl |
| InChI | InChI=1S/C7H15NO.ClH/c1-5-6(8)3-2-4-7(5)9;/h5-7,9H,2-4,8H2,1H3;1H/t5-,6+,7+;/m1./s1 |
| InChIKey | BXGXDXVPVPXOST-NLRFIBDTSA-N |
| XLogP | 0.92 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.66 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,2R,3S)-3-amino-2-methylcyclohexan-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2R,3S)-3-amino-2-methylcyclohexan-1-ol;hydrochloride?
The IUPAC name of (1S,2R,3S)-3-amino-2-methylcyclohexan-1-ol;hydrochloride (CID 134858014) is (1S,2R,3S)-3-amino-2-methylcyclohexan-1-ol;hydrochloride.
What is the SMILES notation for (1S,2R,3S)-3-amino-2-methylcyclohexan-1-ol;hydrochloride?
The canonical SMILES for (1S,2R,3S)-3-amino-2-methylcyclohexan-1-ol;hydrochloride is C[C@@H]1[C@@H](N)CCC[C@@H]1O.Cl.
What is the InChIKey of (1S,2R,3S)-3-amino-2-methylcyclohexan-1-ol;hydrochloride?
The InChIKey is BXGXDXVPVPXOST-NLRFIBDTSA-N. The full InChI is InChI=1S/C7H15NO.ClH/c1-5-6(8)3-2-4-7(5)9;/h5-7,9H,2-4,8H2,1H3;1H/t5-,6+,7+;/m1./s1.
What are the key properties of (1S,2R,3S)-3-amino-2-methylcyclohexan-1-ol;hydrochloride?
(1S,2R,3S)-3-amino-2-methylcyclohexan-1-ol;hydrochloride has a molecular weight of 165.66 g/mol, XLogP of 0.92, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2R,3S)-3-amino-2-methylcyclohexan-1-ol;hydrochloride is sourced from PubChem (CID 134858014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).