C10H15N3O4 — CID 134858120
(3R,5S,6R,7S)-5,6-dimethoxy-4,8-dioxa-1,12,13-triazatricyclo[8.3.0.03,7]trideca-10,12-diene (PubChem CID 134858120) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is (3R,5S,6R,7S)-5,6-dimethoxy-4,8-dioxa-1,12,13-triazatricyclo[8.3.0.03,7]trideca-10,12-diene.
| Compound Name | (3R,5S,6R,7S)-5,6-dimethoxy-4,8-dioxa-1,12,13-triazatricyclo[8.3.0.03,7]trideca-10,12-diene |
|---|---|
| PubChem CID | 134858120 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | (3R,5S,6R,7S)-5,6-dimethoxy-4,8-dioxa-1,12,13-triazatricyclo[8.3.0.03,7]trideca-10,12-diene |
| SMILES | CO[C@H]1O[C@@H]2Cn3nncc3CO[C@@H]2[C@H]1OC |
| InChI | InChI=1S/C10H15N3O4/c1-14-9-8-7(17-10(9)15-2)4-13-6(5-16-8)3-11-12-13/h3,7-10H,4-5H2,1-2H3/t7-,8+,9-,10+/m1/s1 |
| InChIKey | NRSSFSVHYIMLAY-RGOKHQFPSA-N |
| XLogP | -0.44 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |