C13H28O2Si — CID 134858233
(4S)-4-[tert-butyl(dimethyl)silyl]oxyhept-6-en-1-ol (PubChem CID 134858233) has the molecular formula C13H28O2Si and a molecular weight of 244.45 g/mol. Its IUPAC name is (4S)-4-[tert-butyl(dimethyl)silyl]oxyhept-6-en-1-ol.
| Compound Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxyhept-6-en-1-ol |
|---|---|
| PubChem CID | 134858233 |
| Molecular Formula | C13H28O2Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxyhept-6-en-1-ol |
| SMILES | C=CC[C@H](CCCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H28O2Si/c1-7-9-12(10-8-11-14)15-16(5,6)13(2,3)4/h7,12,14H,1,8-11H2,2-6H3/t12-/m1/s1 |
| InChIKey | FSAZDNOOYLAPCW-GFCCVEGCSA-N |
| XLogP | 3.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|