C10H16N2 — CID 134858330
(1R,4S)-1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diimine (PubChem CID 134858330) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (1R,4S)-1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diimine.
| Compound Name | (1R,4S)-1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diimine |
|---|---|
| PubChem CID | 134858330 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (1R,4S)-1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diimine |
| SMILES | [H]/N=C1C(=N\[H])\[C@H]2CC[C@]\1(C)C2(C)C |
| InChI | InChI=1S/C10H16N2/c1-9(2)6-4-5-10(9,3)8(12)7(6)11/h6,11-12H,4-5H2,1-3H3/b11-7+,12-8+/t6-,10+/m1/s1 |
| InChIKey | LMKRIIKKJAKMEI-FVFOKTBTSA-N |
| XLogP | 2.48 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|