C13H17NO2 — CID 134858442
7-ethynyl-1,5,7-trimethyl-3-azabicyclo[3.3.1]nonane-2,4-dione (PubChem CID 134858442) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 7-ethynyl-1,5,7-trimethyl-3-azabicyclo[3.3.1]nonane-2,4-dione.
| Compound Name | 7-ethynyl-1,5,7-trimethyl-3-azabicyclo[3.3.1]nonane-2,4-dione |
|---|---|
| PubChem CID | 134858442 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 7-ethynyl-1,5,7-trimethyl-3-azabicyclo[3.3.1]nonane-2,4-dione |
| SMILES | C#CC1(C)CC2(C)CC(C)(C1)C(=O)NC2=O |
| InChI | InChI=1S/C13H17NO2/c1-5-11(2)6-12(3)8-13(4,7-11)10(16)14-9(12)15/h1H,6-8H2,2-4H3,(H,14,15,16) |
| InChIKey | SNZDIWINXZEQMW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|