C10H17N — CID 134858474
2-ethyl-1,3,3a,4,7,7a-hexahydroisoindole (PubChem CID 134858474) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 2-ethyl-1,3,3a,4,7,7a-hexahydroisoindole.
| Compound Name | 2-ethyl-1,3,3a,4,7,7a-hexahydroisoindole |
|---|---|
| PubChem CID | 134858474 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 2-ethyl-1,3,3a,4,7,7a-hexahydroisoindole |
| SMILES | CCN1CC2CC=CCC2C1 |
| InChI | InChI=1S/C10H17N/c1-2-11-7-9-5-3-4-6-10(9)8-11/h3-4,9-10H,2,5-8H2,1H3 |
| InChIKey | BTFSNJSZEDHLBN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|