About methyl (4Z)-3-(2,2-dimethylpropyl)-4-(trimethylsilylmethylidene)oxolane-3-carboxylate
methyl (4Z)-3-(2,2-dimethylpropyl)-4-(trimethylsilylmethylidene)oxolane-3-carboxylate (PubChem CID 134858476) has the molecular formula C15H28O3Si
and a molecular weight of 284.47 g/mol. Its IUPAC name is methyl (4Z)-3-(2,2-dimethylpropyl)-4-(trimethylsilylmethylidene)oxolane-3-carboxylate.
Molecular Properties
| Compound Name | methyl (4Z)-3-(2,2-dimethylpropyl)-4-(trimethylsilylmethylidene)oxolane-3-carboxylate |
| PubChem CID | 134858476 |
| Molecular Formula | C15H28O3Si |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | methyl (4Z)-3-(2,2-dimethylpropyl)-4-(trimethylsilylmethylidene)oxolane-3-carboxylate |
| SMILES | COC(=O)C1(CC(C)(C)C)COC/C1=C\[Si](C)(C)C |
| InChI | InChI=1S/C15H28O3Si/c1-14(2,3)10-15(13(16)17-4)11-18-8-12(15)9-19(5,6)7/h9H,8,10-11H2,1-7H3/b12-9+ |
| InChIKey | WTZJSPORFYBFEZ-FMIVXFBMSA-N |
| XLogP | 3.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl (4Z)-3-(2,2-dimethylpropyl)-4-(trimethylsilylmethylidene)oxolane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (4Z)-3-(2,2-dimethylpropyl)-4-(trimethylsilylmethylidene)oxolane-3-carboxylate?
The IUPAC name of methyl (4Z)-3-(2,2-dimethylpropyl)-4-(trimethylsilylmethylidene)oxolane-3-carboxylate (CID 134858476) is methyl (4Z)-3-(2,2-dimethylpropyl)-4-(trimethylsilylmethylidene)oxolane-3-carboxylate.
What is the SMILES notation for methyl (4Z)-3-(2,2-dimethylpropyl)-4-(trimethylsilylmethylidene)oxolane-3-carboxylate?
The canonical SMILES for methyl (4Z)-3-(2,2-dimethylpropyl)-4-(trimethylsilylmethylidene)oxolane-3-carboxylate is COC(=O)C1(CC(C)(C)C)COC/C1=C\[Si](C)(C)C.
What is the InChIKey of methyl (4Z)-3-(2,2-dimethylpropyl)-4-(trimethylsilylmethylidene)oxolane-3-carboxylate?
The InChIKey is WTZJSPORFYBFEZ-FMIVXFBMSA-N. The full InChI is InChI=1S/C15H28O3Si/c1-14(2,3)10-15(13(16)17-4)11-18-8-12(15)9-19(5,6)7/h9H,8,10-11H2,1-7H3/b12-9+.
What are the key properties of methyl (4Z)-3-(2,2-dimethylpropyl)-4-(trimethylsilylmethylidene)oxolane-3-carboxylate?
methyl (4Z)-3-(2,2-dimethylpropyl)-4-(trimethylsilylmethylidene)oxolane-3-carboxylate has a molecular weight of 284.47 g/mol, XLogP of 3.42, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4Z)-3-(2,2-dimethylpropyl)-4-(trimethylsilylmethylidene)oxolane-3-carboxylate is sourced from PubChem (CID 134858476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).